2612-72-8 Usage
Uses
Used in Pharmaceutical Industry:
Benzothiazole, 2-(3-pyridinyl)-, is used as a key intermediate in the synthesis of pharmaceuticals for its antimicrobial, antifungal, and anticancer properties. Its ability to modulate multiple biological pathways and target specific cellular processes makes it a promising candidate for the development of new drugs to combat various diseases.
Used in Agrochemical Industry:
In the agrochemical sector, Benzothiazole, 2-(3-pyridinyl)-, is utilized as a component in the formulation of pesticides and fungicides. Its antimicrobial and antifungal properties contribute to the control of plant pathogens, thereby enhancing crop protection and yield.
Used in Dye Industry:
Benzothiazole, 2-(3-pyridinyl)-, is employed as a building block in the production of dyes due to its ability to impart color and stability to the final product. Its chemical structure allows for the creation of dyes with specific properties, such as lightfastness and resistance to fading, making it suitable for various applications, including textiles, plastics, and printing inks.
Used in Chemical Intermediates:
Benzothiazole, 2-(3-pyridinyl)-, serves as an important intermediate in the synthesis of various specialty chemicals, including rubber accelerators and corrosion inhibitors. Its unique structure and reactivity enable the development of products with enhanced performance characteristics, such as improved durability and resistance to environmental factors.
Check Digit Verification of cas no
The CAS Registry Mumber 2612-72-8 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,6,1 and 2 respectively; the second part has 2 digits, 7 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 2612-72:
(6*2)+(5*6)+(4*1)+(3*2)+(2*7)+(1*2)=68
68 % 10 = 8
So 2612-72-8 is a valid CAS Registry Number.
InChI:InChI=1/C12H8N2S/c1-2-6-11-10(5-1)14-12(15-11)9-4-3-7-13-8-9/h1-8H
