261765-64-4 Usage
Uses
Used in Pharmaceutical Industry:
4-Chloro-2-(methylthio)-6-(propylamino)pyrimidine is used as a key intermediate in the synthesis of pharmaceutical compounds for its potential antiviral and antitumor properties. Its unique structural features allow for the development of new drugs that can target specific biological pathways, offering therapeutic benefits in the treatment of viral infections and various types of cancer.
Used in Agrochemical Industry:
In the agrochemical sector, 4-Chloro-2-(methylthio)-6-(propylamino)pyrimidine serves as a valuable building block for the creation of new agrochemicals. Its chemical versatility enables the design of compounds that can be used for pest control, crop protection, and other agricultural applications, thereby contributing to increased crop yields and food security.
Used in Research and Development:
4-Chloro-2-(methylthio)-6-(propylamino)pyrimidine is also utilized in research and development settings as a chemical probe to explore the mechanisms of action of potential antiviral and antitumor agents. Its unique structural elements provide a foundation for understanding how these compounds interact with biological targets, which can inform the design of more effective and selective therapeutics.
Check Digit Verification of cas no
The CAS Registry Mumber 261765-64-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,6,1,7,6 and 5 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 261765-64:
(8*2)+(7*6)+(6*1)+(5*7)+(4*6)+(3*5)+(2*6)+(1*4)=154
154 % 10 = 4
So 261765-64-4 is a valid CAS Registry Number.
InChI:InChI=1/C8H12ClN3S/c1-3-4-10-7-5-6(9)11-8(12-7)13-2/h5H,3-4H2,1-2H3,(H,10,11,12)
