26279-64-1 Usage
General Description
2,6-diamino-5H-pyrimidin-4-one, also known as cytosine, is a chemical compound and one of the four main nucleobases found in DNA and RNA. It is a heterocyclic aromatic organic compound with the formula C4H5N3O. Cytosine plays a crucial role in the genetic code by pairing with guanine through three hydrogen bonds, contributing to the stability of the DNA double helix. It is also involved in the regulation of gene expression and carries out various important functions in cellular metabolism. Additionally, cytosine can undergo chemical modifications, such as methylation, which can impact gene expression and cellular processes.
Check Digit Verification of cas no
The CAS Registry Mumber 26279-64-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,6,2,7 and 9 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 26279-64:
(7*2)+(6*6)+(5*2)+(4*7)+(3*9)+(2*6)+(1*4)=131
131 % 10 = 1
So 26279-64-1 is a valid CAS Registry Number.
InChI:InChI=1/C4H6N4O/c5-2-1-3(9)8-4(6)7-2/h1H2,(H4,5,6,7,8,9)
