263349-24-2 Usage
Uses
Used in Pharmaceutical Industry:
3-BROMO-4-(N-MORPHOLINO)BENZALDEHYDE is used as an intermediate for the synthesis of various pharmaceuticals, contributing to the development of potential drug candidates for a range of diseases. Its presence in the molecular structure of these drug candidates allows for the exploration of new therapeutic applications.
Used in Agrochemical Industry:
3-BROMO-4-(N-MORPHOLINO)BENZALDEHYDE is utilized as a key intermediate in the synthesis of agrochemicals, aiding in the development of effective compounds for agricultural applications, such as pesticides and herbicides.
Used in Organic Synthesis:
3-BROMO-4-(N-MORPHOLINO)BENZALDEHYDE is employed as a versatile building block in organic synthesis, enabling the creation of a wide array of chemical entities. Its bromo and aldehyde functional groups facilitate various organic transformations and reactions, expanding its utility in the synthesis of complex molecules.
Used in Medicinal Chemistry:
3-BROMO-4-(N-MORPHOLINO)BENZALDEHYDE is used as a valuable tool in medicinal chemistry for the discovery and development of new chemical entities with potential therapeutic applications. Its unique structure allows researchers to explore its properties and reactivity in the context of drug design and optimization.
Check Digit Verification of cas no
The CAS Registry Mumber 263349-24-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,6,3,3,4 and 9 respectively; the second part has 2 digits, 2 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 263349-24:
(8*2)+(7*6)+(6*3)+(5*3)+(4*4)+(3*9)+(2*2)+(1*4)=142
142 % 10 = 2
So 263349-24-2 is a valid CAS Registry Number.
InChI:InChI=1/C11H12BrNO2/c12-10-7-9(8-14)1-2-11(10)13-3-5-15-6-4-13/h1-2,7-8H,3-6H2
