26351-19-9 Usage
Description
Violuric Acid Monohydrate is a solid powder chemical compound that serves as a reagent and pharmaceutical intermediate. It is known for its specific applications in various industries due to its unique chemical properties.
Uses
Used in Chemical Industry:
Violuric Acid Monohydrate is used as a reagent for cobalt. It plays a crucial role in the chemical analysis and identification of cobalt, which is an essential element in various industrial applications, including the production of alloys, magnets, and batteries.
Used in Pharmaceutical Industry:
Violuric Acid Monohydrate is used as a pharmaceutical intermediate. It serves as a key component in the synthesis of various drugs, contributing to the development of new medications and therapies. Its presence in the pharmaceutical industry highlights its importance in the creation of life-saving and life-enhancing drugs.
Check Digit Verification of cas no
The CAS Registry Mumber 26351-19-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,6,3,5 and 1 respectively; the second part has 2 digits, 1 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 26351-19:
(7*2)+(6*6)+(5*3)+(4*5)+(3*1)+(2*1)+(1*9)=99
99 % 10 = 9
So 26351-19-9 is a valid CAS Registry Number.
InChI:InChI=1/C4H3N3O4.H2O/c8-2-1(7-11)3(9)6-4(10)5-2;/h11H,(H2,5,6,8,9,10);1H2
