26396-57-6 Usage
Description
1-(2,4-DICHLORO-PHENYL)-PYRROLE-2,5-DIONE is a synthetic chemical compound characterized by the presence of a pyrrole ring and two chlorine atoms attached to the phenyl group. 1-(2,4-DICHLORO-PHENYL)-PYRROLE-2,5-DIONE is recognized for its potential pharmacological activities, such as antioxidant, antitumor, and antimicrobial properties, and is also of interest for its electronic properties in the context of organic electronic devices.
Used in Pharmaceutical Industry:
1-(2,4-DICHLORO-PHENYL)-PYRROLE-2,5-DIONE is used as a chemical intermediate for the synthesis of various pharmaceuticals. Its unique structure and properties make it a valuable component in the development of new drugs, particularly those targeting specific diseases or conditions.
Used in Agrochemical Industry:
In the agrochemical sector, 1-(2,4-DICHLORO-PHENYL)-PYRROLE-2,5-DIONE serves as an intermediate in the production of agrochemicals. Its role in this industry is crucial for the synthesis of compounds that can protect crops from pests and diseases, thereby ensuring food security and agricultural productivity.
Used in Dye Industry:
1-(2,4-DICHLORO-PHENYL)-PYRROLE-2,5-DIONE is utilized as a precursor in the synthesis of dyes. Its chemical structure contributes to the color and stability of the dyes, making it an essential component in the production of various types of dyes used in textiles, printing, and other applications.
Used in Organic Electronic Devices:
Due to its electronic properties, 1-(2,4-DICHLORO-PHENYL)-PYRROLE-2,5-DIONE has been studied for its potential use in organic electronic devices. Its application in this field could contribute to the development of more efficient and sustainable electronic components, such as organic light-emitting diodes (OLEDs) and organic solar cells.
Used in Antioxidant Applications:
1-(2,4-DICHLORO-PHENYL)-PYRROLE-2,5-DIONE has been investigated for its antioxidant properties, which could be beneficial in various applications, such as in the food industry to prevent oxidation and spoilage, or in cosmetic products to protect against environmental damage.
Used in Antitumor Applications:
1-(2,4-DICHLORO-PHENYL)-PYRROLE-2,5-DIONE has shown potential antitumor activity, making it a candidate for further research and development as a therapeutic agent in oncology. Its use in this area could lead to the discovery of new treatments for various types of cancer.
Used in Antimicrobial Applications:
1-(2,4-DICHLORO-PHENYL)-PYRROLE-2,5-DIONE's antimicrobial properties suggest its potential use in applications where controlling the growth of microorganisms is essential, such as in the development of antimicrobial coatings for medical devices or in the production of disinfectants.
Check Digit Verification of cas no
The CAS Registry Mumber 26396-57-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,6,3,9 and 6 respectively; the second part has 2 digits, 5 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 26396-57:
(7*2)+(6*6)+(5*3)+(4*9)+(3*6)+(2*5)+(1*7)=136
136 % 10 = 6
So 26396-57-6 is a valid CAS Registry Number.
InChI:InChI=1/C10H5Cl2NO2/c11-6-1-2-8(7(12)5-6)13-9(14)3-4-10(13)15/h1-5H