26402-31-3 Usage
Uses
Used in Plasticizer Industry:
Propylene glycol monoricinoleate is used as a plasticizer to increase the flexibility and workability of various materials, such as polymers and resins. Its ability to enhance the properties of these materials makes it a valuable component in the production of flexible plastics.
Used in Dye Industry:
In the dye industry, propylene glycol monoricinoleate serves as a dye solvent, enabling the efficient dissolution and application of dyes in various processes. Its solubility in organic solvents facilitates the even distribution of dyes, ensuring consistent coloration.
Used in Lubricant Industry:
As a lubricant, propylene glycol monoricinoleate reduces friction between surfaces, leading to improved performance and reduced wear in mechanical systems. Its viscous nature contributes to its effectiveness as a lubricant.
Used in Cosmetics Industry:
In cosmetics, propylene glycol monoricinoleate is used to improve the texture, consistency, and stability of various products. Its ability to blend well with other ingredients makes it a versatile component in the formulation of creams, lotions, and other cosmetic products.
Used in Urethane Polymers Industry:
Propylene glycol monoricinoleate is utilized in the production of urethane polymers, contributing to the formation of flexible, durable materials with a wide range of applications, from coatings to adhesives.
Used in Hydraulic Fluids Industry:
In hydraulic fluids, propylene glycol monoricinoleate plays a crucial role in ensuring the smooth operation of hydraulic systems. Its viscosity and lubricating properties help maintain the efficiency and longevity of these systems.
Check Digit Verification of cas no
The CAS Registry Mumber 26402-31-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,6,4,0 and 2 respectively; the second part has 2 digits, 3 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 26402-31:
(7*2)+(6*6)+(5*4)+(4*0)+(3*2)+(2*3)+(1*1)=83
83 % 10 = 3
So 26402-31-3 is a valid CAS Registry Number.
InChI:InChI=1/C21H40O4/c1-3-4-5-12-15-20(23)16-13-10-8-6-7-9-11-14-17-21(24)25-18-19(2)22/h10,13,19-20,22-23H,3-9,11-12,14-18H2,1-2H3/b13-10-
