26419-14-7 Usage
Uses
Used in Chemical Synthesis:
1,3-Dioxane,5-(1-methylethylidene)-2-phenyl-(9CI) is used as an intermediate in the synthesis of other compounds. Its unique structure allows it to participate in various chemical reactions, facilitating the creation of a range of products.
Used in Pharmaceutical Production:
In the pharmaceutical industry, 1,3-Dioxane,5-(1-methylethylidene)-2-phenyl-(9CI) is utilized in the production of certain drugs. Its role in the synthesis process is crucial for the development of medications that address specific health conditions.
Used in Solvent Applications:
1,3-Dioxane,5-(1-methylethylidene)-2-phenyl-(9CI) is also employed as a solvent in various industrial processes. Its ability to dissolve a wide range of substances makes it a valuable component in the manufacturing of different products.
Used in Consumer Product Formulation:
1,3-Dioxane,5-(1-methylethylidene)-2-phenyl-(9CI) is incorporated into the formulation of various consumer products. Its presence in these products can be attributed to its capacity to enhance the performance or stability of the final product.
Check Digit Verification of cas no
The CAS Registry Mumber 26419-14-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,6,4,1 and 9 respectively; the second part has 2 digits, 1 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 26419-14:
(7*2)+(6*6)+(5*4)+(4*1)+(3*9)+(2*1)+(1*4)=107
107 % 10 = 7
So 26419-14-7 is a valid CAS Registry Number.
InChI:InChI=1/C13H16O2/c1-10(2)12-8-14-13(15-9-12)11-6-4-3-5-7-11/h3-7,13H,8-9H2,1-2H3
