26438-48-2 Usage
Uses
Used in Pharmaceutical Industry:
1-hydroxy-3-methyl-4-oxy-1H-quinoxalin-2-one is used as a therapeutic agent for its potential antioxidant and antitumor activities. Its unique structure and properties make it a promising candidate for the development of new drugs targeting various diseases, including cancer.
Used in Medicinal Chemistry:
1-hydroxy-3-methyl-4-oxy-1H-quinoxalin-2-one is used as a chemical intermediate in the synthesis of other bioactive compounds. Its versatile structure allows for further functionalization and modification, enabling the development of novel therapeutic agents with improved pharmacological properties.
Used in Organic Synthesis:
1-hydroxy-3-methyl-4-oxy-1H-quinoxalin-2-one is used as a building block in the synthesis of complex organic molecules. Its reactivity and structural features make it a valuable component in the construction of various organic compounds, including pharmaceuticals, agrochemicals, and materials.
Used in Biotechnology Industry:
1-hydroxy-3-methyl-4-oxy-1H-quinoxalin-2-one is used as a research tool in biotechnology applications. Its potential therapeutic properties and unique structure make it an interesting subject for further investigation, leading to the discovery of new biological targets and the development of innovative therapeutic strategies.
Check Digit Verification of cas no
The CAS Registry Mumber 26438-48-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,6,4,3 and 8 respectively; the second part has 2 digits, 4 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 26438-48:
(7*2)+(6*6)+(5*4)+(4*3)+(3*8)+(2*4)+(1*8)=122
122 % 10 = 2
So 26438-48-2 is a valid CAS Registry Number.
InChI:InChI=1/C9H8N2O3/c1-6-9(12)11(14)8-5-3-2-4-7(8)10(6)13/h2-5,14H,1H3
