26447-28-9 Usage
General Description
2-Furancarboxylic acid is a key chemical compound with the molecular formula C5H4O3. It is a organic compound containing a furan ring with a carboxylic acid group, and it is generally used as a precursor for the synthesis of various pharmaceuticals, agrochemicals, and organic materials. 2-Furancarboxylic acid can be synthesized through the oxidation of furfural or by the decarboxylation of 5-hydroxymethylfurfural. It exhibits diverse properties and can be used in the production of various polymers and resins. Additionally, 2-furancarboxylic acid has potential applications in the development of bio-based materials and green chemicals due to its renewable and sustainable nature. Overall, 2-furancarboxylic acid is a versatile compound with a wide range of applications in the chemical industry.
Check Digit Verification of cas no
The CAS Registry Mumber 26447-28-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,6,4,4 and 7 respectively; the second part has 2 digits, 2 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 26447-28:
(7*2)+(6*6)+(5*4)+(4*4)+(3*7)+(2*2)+(1*8)=119
119 % 10 = 9
So 26447-28-9 is a valid CAS Registry Number.
InChI:InChI=1/C5H4O3/c6-5(7)4-2-1-3-8-4/h1-3H,(H,6,7)
C:Corrosive;
