2646-51-7 Usage
Description
4-HYDROXY-3-IODO-5-NITRO-PHENYLACETIC ACID is a monocarboxylic acid derived from phenylacetic acid, featuring iodo, hydroxy, and nitro substituents at positions 3, 4, and 5 respectively. This chemical compound possesses unique structural properties that make it suitable for various applications across different industries.
Uses
Used in Pharmaceutical Industry:
4-HYDROXY-3-IODO-5-NITRO-PHENYLACETIC ACID is used as an active pharmaceutical ingredient for the development of drugs targeting specific medical conditions. Its unique structure allows for potential interactions with biological targets, making it a promising candidate for drug discovery and development.
Used in Chemical Synthesis:
In the chemical industry, 4-HYDROXY-3-IODO-5-NITRO-PHENYLACETIC ACID can be used as a key intermediate in the synthesis of various complex organic compounds. Its functional groups enable further chemical modifications, leading to the creation of novel molecules with specific properties and applications.
Used in Research and Development:
4-HYDROXY-3-IODO-5-NITRO-PHENYLACETIC ACID serves as an important research tool in the field of biochemistry and molecular biology. It can be employed in the study of enzyme mechanisms, protein interactions, and cellular processes, contributing to a better understanding of biological systems and the development of targeted therapies.
Used in Analytical Chemistry:
4-HYDROXY-3-IODO-5-NITRO-PHENYLACETIC ACID can be utilized in analytical chemistry as a reference material or a standard for the calibration of analytical instruments. Its distinct chemical properties make it suitable for various analytical techniques, such as high-performance liquid chromatography (HPLC), mass spectrometry, and nuclear magnetic resonance (NMR) spectroscopy.
Check Digit Verification of cas no
The CAS Registry Mumber 2646-51-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,6,4 and 6 respectively; the second part has 2 digits, 5 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 2646-51:
(6*2)+(5*6)+(4*4)+(3*6)+(2*5)+(1*1)=87
87 % 10 = 7
So 2646-51-7 is a valid CAS Registry Number.
InChI:InChI=1/C8H6INO5/c9-5-1-4(3-7(11)12)2-6(8(5)13)10(14)15/h1-2,13H,3H2,(H,11,12)