2647-14-5 Usage
General Description
The "CHLORIDE STANDARD" is a solution containing a known concentration of chloride ions in a solvent, typically water. It is used as a reference material for calibrating instruments and testing the accuracy of chloride measurements in various applications such as environmental monitoring, water treatment, and industrial processes. The standard is usually prepared by dissolving a precise amount of a chloride compound, such as sodium chloride, in water to create a solution with a known concentration of chloride ions. This allows for the accurate comparison and validation of chloride measurements in different samples and ensures the reliability of analytical results.
Check Digit Verification of cas no
The CAS Registry Mumber 2647-14-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,6,4 and 7 respectively; the second part has 2 digits, 1 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 2647-14:
(6*2)+(5*6)+(4*4)+(3*7)+(2*1)+(1*4)=85
85 % 10 = 5
So 2647-14-5 is a valid CAS Registry Number.
InChI:InChI=1/C14H18F2N2O/c1-2-11-5-3-4-6-13(11)18(7-8-19)10-12(9-17)14(15)16/h3-6,12,14,19H,2,7-8,10H2,1H3