26513-80-4 Usage
Uses
Used in Pharmaceutical Industry:
2-[(3-OXO-3,4-DIHYDRO-2H-1,4-BENZOXAZIN-6-YL)CARBONYL]BENZENECARBOXYLIC ACID is used as a potential therapeutic agent for its antioxidant and anti-inflammatory properties. Its ability to modulate biological processes may contribute to the development of new drugs for various health conditions.
Used in Agricultural Industry:
2-[(3-OXO-3,4-DIHYDRO-2H-1,4-BENZOXAZIN-6-YL)CARBONYL]BENZENECARBOXYLIC ACID may be used as a natural pesticide or herbicide due to its potential biological activities. Further research is needed to explore its effectiveness and safety in agricultural applications.
Further research is needed to fully understand the potential uses and effects of 2-[(3-OXO-3,4-DIHYDRO-2H-1,4-BENZOXAZIN-6-YL)CARBONYL]BENZENECARBOXYLIC ACID in various industries. Its unique chemical structure and biological properties make it a promising candidate for future applications.
Check Digit Verification of cas no
The CAS Registry Mumber 26513-80-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,6,5,1 and 3 respectively; the second part has 2 digits, 8 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 26513-80:
(7*2)+(6*6)+(5*5)+(4*1)+(3*3)+(2*8)+(1*0)=104
104 % 10 = 4
So 26513-80-4 is a valid CAS Registry Number.
InChI:InChI=1/C16H11NO5/c18-14-8-22-13-6-5-9(7-12(13)17-14)15(19)10-3-1-2-4-11(10)16(20)21/h1-7H,8H2,(H,17,18)(H,20,21)/p-1
