265136-65-0 Usage
Uses
Used in Pharmaceutical Research:
Ethyl 3-amino-4-(2-phthalimidoethoxy)crotonate is used as a research compound for exploring its potential biological activity and pharmacological properties. Its unique structure and functional groups make it a promising candidate for the development of new drugs and therapeutic agents.
Used in Organic Synthesis:
Ethyl 3-amino-4-(2-phthalimidoethoxy)crotonate is used as a key intermediate in the synthesis of various organic compounds. Its versatile structure allows for further functionalization and modification, enabling the creation of a wide range of molecules with diverse applications.
Used in Drug Development:
Ethyl 3-amino-4-(2-phthalimidoethoxy)crotonate is used as a building block in the development of new drugs and therapeutic agents. Its potential pharmacological properties make it a valuable component in the design and synthesis of novel pharmaceuticals.
Used in Agrochemical Production:
Ethyl 3-amino-4-(2-phthalimidoethoxy)crotonate is employed as an intermediate in the production of various agrochemicals. Its unique structure and functional groups contribute to the development of effective and targeted agrochemicals for agricultural applications.
Check Digit Verification of cas no
The CAS Registry Mumber 265136-65-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,6,5,1,3 and 6 respectively; the second part has 2 digits, 6 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 265136-65:
(8*2)+(7*6)+(6*5)+(5*1)+(4*3)+(3*6)+(2*6)+(1*5)=140
140 % 10 = 0
So 265136-65-0 is a valid CAS Registry Number.
InChI:InChI=1/C16H18N2O5/c1-2-23-14(19)9-11(17)10-22-8-7-18-15(20)12-5-3-4-6-13(12)16(18)21/h3-6,9H,2,7-8,10,17H2,1H3/b11-9-
