26529-14-6 Usage
General Description
The chemical compound [(2E,5E)-2,5-bis(anilinomethylidene)cyclopentylidene]-diphenyl-azanium perchlorate is a complex organic molecule comprised of a cyclopentylidene ring with anilinomethylidene groups attached to it, and two diphenyl-azanium (phenylammonium) cations connected to a perchlorate anion. [(2E,5E)-2,5-bis(anilinomethylidene)cyclopentylidene]-diphenyl-azanium perchlorate is a salt, with the positively charged diphenyl-azanium cations balancing out the negatively charged perchlorate anion. It is likely to have applications in organic chemistry and material science due to the specific arrangement of its functional groups, which can potentially lead to interesting reactivity and properties. However, further research is needed to fully understand the potential uses and implications of this compound.
Check Digit Verification of cas no
The CAS Registry Mumber 26529-14-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,6,5,2 and 9 respectively; the second part has 2 digits, 1 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 26529-14:
(7*2)+(6*6)+(5*5)+(4*2)+(3*9)+(2*1)+(1*4)=116
116 % 10 = 6
So 26529-14-6 is a valid CAS Registry Number.
InChI:InChI=1/C31H27N3.ClHO4/c1-5-13-27(14-6-1)32-23-25-21-22-26(24-33-28-15-7-2-8-16-28)31(25)34(29-17-9-3-10-18-29)30-19-11-4-12-20-30;2-1(3,4)5/h1-20,23-24H,21-22H2,(H,32,33);(H,2,3,4,5)