2653-66-9 Usage
Uses
Used in Dye Industry:
1-(2-Naphtylazo)-2-naphthol is used as a colorant for its red orange hue, which is stable and resistant to light and heat. Its properties make it suitable for use in various applications within the dye industry, such as coloring fabrics, plastics, and other materials.
Used in Analytical Chemistry:
1-(2-Naphtylazo)-2-naphthol is used as a reagent in analytical chemistry due to its ability to form magenta color in concentrated sulfuric acid and red brown precipitation upon dilution. This characteristic can be utilized for the detection and quantification of specific substances in various chemical analyses.
Used in Pharmaceutical Industry:
1-(2-Naphtylazo)-2-naphthol can be used as an intermediate in the synthesis of pharmaceutical compounds, taking advantage of its chemical properties and reactivity with other molecules. Its stability and resistance to heat and light make it a suitable candidate for the development of new drugs and medications.
Used in Research and Development:
Due to its unique properties and reactivity, 1-(2-Naphtylazo)-2-naphthol can be employed in research and development for the creation of new materials, dyes, and chemicals. Its heat and light resistance, as well as its solubility characteristics, make it an interesting compound for further study and potential applications in various industries.
Preparation
Naphthalen-2-amine diazotization, and Naphthalen-2-ol coupling.
Standard
Light Fastness
Melting point
Stable
ISO
Good
Check Digit Verification of cas no
The CAS Registry Mumber 2653-66-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,6,5 and 3 respectively; the second part has 2 digits, 6 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 2653-66:
(6*2)+(5*6)+(4*5)+(3*3)+(2*6)+(1*6)=89
89 % 10 = 9
So 2653-66-9 is a valid CAS Registry Number.
InChI:InChI=1/C20H14N2O/c23-19-12-10-15-6-3-4-8-18(15)20(19)22-21-17-11-9-14-5-1-2-7-16(14)13-17/h1-13,21H/b22-20-