26577-59-3 Usage
Uses
Used in Pharmaceutical Industry:
4-MORPHOLIN-4-YL-3-NITRO-BENZOIC ACID is used as an intermediate in the synthesis of various pharmaceuticals for its ability to contribute to the development of new drugs. Its unique structure allows it to be a key component in the creation of molecules with potential therapeutic effects.
Used in Cancer Research and Treatment:
In the field of oncology, 4-MORPHOLIN-4-YL-3-NITRO-BENZOIC ACID is utilized as a research compound for its potential role in cancer treatment. Its chemical properties may enable the design of drugs that target specific cancer cells, offering new avenues for therapeutic intervention.
Used in Agrochemical Industry:
4-MORPHOLIN-4-YL-3-NITRO-BENZOIC ACID is also used as a building block in the production of agrochemicals, such as pesticides and herbicides. Its chemical structure and properties make it suitable for the development of compounds that can effectively control pests and weeds in agricultural settings.
Check Digit Verification of cas no
The CAS Registry Mumber 26577-59-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,6,5,7 and 7 respectively; the second part has 2 digits, 5 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 26577-59:
(7*2)+(6*6)+(5*5)+(4*7)+(3*7)+(2*5)+(1*9)=143
143 % 10 = 3
So 26577-59-3 is a valid CAS Registry Number.
InChI:InChI=1/C11H12N2O5/c14-11(15)8-1-2-9(10(7-8)13(16)17)12-3-5-18-6-4-12/h1-2,7H,3-6H2,(H,14,15)
26577-59-3Relevant academic research and scientific papers
OXADIAZOLE DIARYL COMPOUNDS
-
Page/Page column 55, (2009/05/29)
The invention relates to compounds of formula (I): wherein R1, R2, Ra , Rb,Rc and W, have the meanings given in claim 1. The compounds are useful e.g. in the treatment of autoimmune disorders, such as multiple sclerosis.
