26614-98-2 Usage
Uses
Used in Pharmaceutical Research:
4-(2-P-Tolyl-ethyl)-piperidine is used as a chemical precursor for the synthesis of various drugs, playing a crucial role in the development of new pharmaceuticals.
Used in Psychoactive Substance Research:
4-(2-P-Tolyl-ethyl)-piperidine is used as a research compound to study its psychoactive properties, which may lead to a better understanding of its effects on the central nervous system and potential applications in therapeutics.
Used in Medication Development:
4-(2-P-Tolyl-ethyl)-piperidine is utilized in the development of new medications aimed at treating various medical conditions, leveraging its pharmacological effects for therapeutic benefits.
While the provided materials do not specify the exact applications or industries for 4-(2-P-Tolyl-ethyl)-piperidine, the general uses listed above are based on its role in pharmaceutical research and development. Further research and development could potentially reveal more specific applications in various industries, such as the medical, pharmaceutical, or chemical industries.
Check Digit Verification of cas no
The CAS Registry Mumber 26614-98-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,6,6,1 and 4 respectively; the second part has 2 digits, 9 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 26614-98:
(7*2)+(6*6)+(5*6)+(4*1)+(3*4)+(2*9)+(1*8)=122
122 % 10 = 2
So 26614-98-2 is a valid CAS Registry Number.
InChI:InChI=1/C14H21N/c1-12-2-4-13(5-3-12)6-7-14-8-10-15-11-9-14/h2-5,14-15H,6-11H2,1H3
