266997-63-1Relevant academic research and scientific papers
Preparation of ruthenium silanethiolato complexes and their reactions with sulfur dioxide; possible models for the activation of SO2 in the homogeneously catalyzed Claus reaction
Kovacs, Istvan,Pearson, Celine,Shaver, Alan
, p. 193 - 203 (2007/10/03)
CpRu(PPh3)2SSiiPr3 (6a) was prepared by reacting [CpRu(PPh3)2(acetone)]BF4 and NaSSiiPr3. Complex 6a is substitution-labile and readily gave the mixed-ligand derivatives CpRu(PPh3)(L)SSiiPr3, where L = CO (6b), PMe3 (6c), P(OMe)3 (6d), upon treatment with the corresponding ligands. CpRu(dppe)SSiiPr3 (6e) was obtained from complex 6a and dppe via the intermediate formation of CpRu(PPh3)(η1-dppe)SSiiPr3. Treatment of complex 6a with one equivalent of SO2 gave primarily unstable CpRu(PPh3)(SO2)SSiiPr3 (6f). However, complexes 6b-e inserted one equivalent of SO2 solely at their S-SiiPr3 function to give the unstable O-silyl thiosulfito complexes CpRu(PPh3)(L)SS(O)OSiiPr3 (L = CO (8b), PMe3 (8c), P(OMe)3 (8d)) as well as CpRu(dppe)SS(O)OSiiPr3 (8e). The S-H bonds of CpRu(PPh3)2SH (7a) and CpRu(dppe)SH (7b) added to PhNSO to give CpRu(PPh3)2SS(O)NHPh (9a) and CpRu(dppe)SS(O)NHPh (9b), respectively. The crystal structure of complex 6a was determined. Crystallographic data for 6a: triclinic, P1, a = 10.642(6) A?, b = 11.068(8) A?, c = 21.994(10) A?, α = 79.27(5)°, β= 89.22(5)°, γ = 62.32(4)°, V = 2246(2) A?3, Z = 2.
