26774-88-9 Usage
Description
(R)-(-)-2-(2,5-Dihydrophenyl)glycine, also known as a cyclohexadiene-based amino acid, is a white powder with unique chemical properties. It plays a crucial role in the synthesis of various pharmaceutical compounds, particularly cephalosporin-type antibiotics.
Uses
Used in Pharmaceutical Industry:
(R)-(-)-2-(2,5-Dihydrophenyl)glycine is used as a key intermediate in the production of cephalosporin-type antibiotics, such as Cephradine (C261800), for its ability to contribute to the development of effective antimicrobial agents. Its unique cyclohexadiene structure allows for the creation of antibiotics with enhanced properties, making it an essential component in the pharmaceutical industry.
Check Digit Verification of cas no
The CAS Registry Mumber 26774-88-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,6,7,7 and 4 respectively; the second part has 2 digits, 8 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 26774-88:
(7*2)+(6*6)+(5*7)+(4*7)+(3*4)+(2*8)+(1*8)=149
149 % 10 = 9
So 26774-88-9 is a valid CAS Registry Number.
InChI:InChI=1/C8H11NO2/c9-7(8(10)11)6-4-2-1-3-5-6/h1-2,5,7H,3-4,9H2,(H,10,11)/t7-/m1/s1
26774-88-9Relevant articles and documents
Tumor-resolving and histolytic medicaments and their use
-
, (2008/06/13)
Dehydrooligopeptides, some of which are known, demonstrate histolytic and tumor-resolving activity and may be used in medicaments causing the lysis of animal tissues and/or tumors in warm-blooded animals.