267876-19-7 Usage
Description
1H-Pyrrolo[2,3-c]pyridine-5-methanamine(9CI) is a chemical compound characterized by its molecular formula C8H8N2. It is an organic compound that features a pyrrolopyridine ring and an amine functional group. 1H-Pyrrolo[2,3-c]pyridine-5-methanamine(9CI) holds potential in the realm of medicinal chemistry and drug discovery due to its capacity to engage with biological targets and potentially influence biological processes. Its distinctive structure and properties render it a promising candidate for pharmaceutical drug development and as a research tool in biochemical studies.
Uses
Used in Medicinal Chemistry:
1H-Pyrrolo[2,3-c]pyridine-5-methanamine(9CI) is utilized as a key component in the development of pharmaceutical drugs. Its unique structure allows it to interact with various biological targets, making it a valuable asset in the creation of new therapeutic agents.
Used in Drug Discovery:
In the field of drug discovery, 1H-Pyrrolo[2,3-c]pyridine-5-methanamine(9CI) serves as a research tool. Its ability to modulate biological processes positions it as a candidate for the identification and optimization of new drug leads.
Used in Biochemical Studies:
1H-Pyrrolo[2,3-c]pyridine-5-methanamine(9CI) is employed as a research compound in biochemical studies. Its interaction with biological targets aids scientists in understanding complex biological mechanisms and pathways, which can contribute to the advancement of medical knowledge and treatment strategies.
Used in Pharmaceutical Drug Development:
1H-Pyrrolo[2,3-c]pyridine-5-methanamine(9CI) is used as a building block in the synthesis of pharmaceutical drugs. Its potential to influence biological processes makes it a crucial component in the development of innovative therapeutics for various medical conditions.
Used in Scientific Research:
In scientific research, 1H-Pyrrolo[2,3-c]pyridine-5-methanamine(9CI) is applied as a compound of interest. Its unique properties and interactions with biological systems provide researchers with insights into the molecular basis of diseases and the discovery of novel treatment approaches.
Check Digit Verification of cas no
The CAS Registry Mumber 267876-19-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,6,7,8,7 and 6 respectively; the second part has 2 digits, 1 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 267876-19:
(8*2)+(7*6)+(6*7)+(5*8)+(4*7)+(3*6)+(2*1)+(1*9)=197
197 % 10 = 7
So 267876-19-7 is a valid CAS Registry Number.
InChI:InChI=1/C8H11N3/c9-4-7-3-6-1-2-10-8(6)5-11-7/h3,5,10H,1-2,4,9H2
