26846-51-5 Usage
Uses
Used in Research Applications:
8-amino-2,6-dibromo-5-hydroxy-4-iminonaphthalen-1(4H)-one is used as a research compound for exploring its chemical properties and potential applications in various fields. The presence of multiple functional groups allows for further chemical modifications and investigations into its reactivity and interactions with other molecules.
Used in Academic Studies:
8-amino-2,6-dibromo-5-hydroxy-4-iminonaphthalen-1(4H)-one serves as a subject of academic studies, where its synthesis, structure, and properties are analyzed. 8-amino-2,6-dibromo-5-hydroxy-4-iminonaphthalen-1(4H)-one may be used to teach students about organic chemistry, synthesis methods, and the importance of functional groups in determining a compound's behavior.
Used in Pharmaceutical Development:
Although information is limited, 8-amino-2,6-dibromo-5-hydroxy-4-iminonaphthalen-1(4H)-one may be used as a starting material or intermediate in the development of new pharmaceutical compounds. Its unique structure and functional groups could potentially be exploited to create novel drugs with specific therapeutic properties.
Used in Chemical Synthesis:
8-amino-2,6-dibromo-5-hydroxy-4-iminonaphthalen-1(4H)-one can be used as a building block in the synthesis of more complex organic compounds. Its functional groups may facilitate reactions with other molecules, leading to the formation of new compounds with potential applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 26846-51-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,6,8,4 and 6 respectively; the second part has 2 digits, 5 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 26846-51:
(7*2)+(6*6)+(5*8)+(4*4)+(3*6)+(2*5)+(1*1)=135
135 % 10 = 5
So 26846-51-5 is a valid CAS Registry Number.
InChI:InChI=1/C10H6Br2N2O2/c11-3-1-5(13)7-8(9(3)15)6(14)2-4(12)10(7)16/h1-2H,13-14H2
