2686-72-8 Usage
Bicyclic structure with two nitrogen atoms
The benzimidazole ring has a bicyclic structure with two nitrogen atoms, which is a key feature of 1H-Benzimidazole,4,5,7-trifluoro-(9CI).
Three fluorine atoms in the 4, 5, and 7 positions
The addition of three fluorine atoms in these positions on the benzimidazole ring gives 1H-Benzimidazole,4,5,7-trifluoro-(9CI) its unique properties.
Building block in the synthesis of pharmaceuticals and agrochemicals
1H-Benzimidazole,4,5,7-trifluoro-(9CI) is primarily used as a building block in the synthesis of various pharmaceuticals and agrochemicals due to its ability to alter the biological activity of compounds.
Used in organic chemistry research
1H-Benzimidazole,4,5,7-trifluoro-(9CI) is also used in organic chemistry research and as a reagent in the production of other chemical compounds.
Reactivity and chemical properties
The specific applications and uses of 1H-Benzimidazole,4,5,7-trifluoro-(9CI) depend on its reactivity and chemical properties, which make it an important tool in various chemical synthesis processes.
Check Digit Verification of cas no
The CAS Registry Mumber 2686-72-8 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,6,8 and 6 respectively; the second part has 2 digits, 7 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 2686-72:
(6*2)+(5*6)+(4*8)+(3*6)+(2*7)+(1*2)=108
108 % 10 = 8
So 2686-72-8 is a valid CAS Registry Number.
InChI:InChI=1/C7H3F3N2/c8-3-1-4(9)6-7(5(3)10)12-2-11-6/h1-2H,(H,11,12)
