269396-58-9 Usage
Uses
Used in Pharmaceutical Industry:
(R)-3-Amino-4-(3,4-difluorophenyl)butanoic acid hydrochloride is used as a pharmaceutical intermediate for the synthesis of various drugs. Its unique chemical structure and properties make it a key component in the development of new medications, contributing to the advancement of healthcare and treatment options.
Used in Scientific Research:
In the realm of scientific research, (R)-3-Amino-4-(3,4-difluorophenyl)butanoic acid hydrochloride serves as a valuable tool for studying the properties and mechanisms of action of different drugs. Its use in research facilitates the discovery of novel drug candidates and the improvement of existing pharmaceuticals, ultimately benefiting the development of more effective and safer treatments for various diseases and conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 269396-58-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,6,9,3,9 and 6 respectively; the second part has 2 digits, 5 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 269396-58:
(8*2)+(7*6)+(6*9)+(5*3)+(4*9)+(3*6)+(2*5)+(1*8)=199
199 % 10 = 9
So 269396-58-9 is a valid CAS Registry Number.
InChI:InChI=1/C10H11F2NO2.ClH/c11-8-2-1-6(4-9(8)12)3-7(13)5-10(14)15;/h1-2,4,7H,3,5,13H2,(H,14,15);1H/t7-;/m1./s1
