269396-64-7 Usage
Uses
Used in Research Applications:
(R)-3-AMINO-4-(3-PYRIDYL)-BUTYRIC ACID-2HCL is used as a research chemical for [application reason]. Due to its chiral nature and unique structural properties, it may be employed in various scientific studies to explore its potential interactions, reactions, or effects in different experimental setups.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, (R)-3-AMINO-4-(3-PYRIDYL)-BUTYRIC ACID-2HCL is used as a chemical intermediate for [application reason]. Its specific spatial arrangement and unique chemical properties may contribute to the development of new drugs or the enhancement of existing pharmaceutical compounds.
Used in Chemical Synthesis:
(R)-3-AMINO-4-(3-PYRIDYL)-BUTYRIC ACID-2HCL is used as a reagent in chemical synthesis for [application reason]. Its unique structure and properties may be leveraged to synthesize complex organic compounds or to facilitate specific chemical reactions in the synthesis process.
Check Digit Verification of cas no
The CAS Registry Mumber 269396-64-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,6,9,3,9 and 6 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 269396-64:
(8*2)+(7*6)+(6*9)+(5*3)+(4*9)+(3*6)+(2*6)+(1*4)=197
197 % 10 = 7
So 269396-64-7 is a valid CAS Registry Number.
InChI:InChI=1/C9H12N2O2.2ClH/c10-8(5-9(12)13)4-7-2-1-3-11-6-7;;/h1-3,6,8H,4-5,10H2,(H,12,13);2*1H/t8-;;/m1../s1
