269398-79-0 Usage
Uses
Used in Pharmaceutical Research:
(R)-3-AMINO-4-(2-METHYLPHENYL)BUTANOIC ACID HYDROCHLORIDE is used as a key intermediate in the synthesis of new medications and therapeutic compounds. Its unique structure and properties make it a promising candidate for the development of innovative drugs with potential applications in treating various diseases and medical conditions.
Used in Organic Synthesis:
In the field of organic synthesis, (R)-3-AMINO-4-(2-METHYLPHENYL)BUTANOIC ACID HYDROCHLORIDE is utilized as a versatile building block for the creation of complex organic molecules. Its reactivity and functional groups allow chemists to construct a wide range of compounds with diverse applications.
Used in Chemistry:
(R)-3-AMINO-4-(2-METHYLPHENYL)BUTANOIC ACID HYDROCHLORIDE may have potential uses in the field of chemistry, where its unique properties can be exploited for various chemical reactions and processes. Its ability to form salts and participate in different types of chemical transformations makes it a valuable compound for research and development.
Used in Biochemistry:
In biochemistry, (R)-3-AMINO-4-(2-METHYLPHENYL)BUTANOIC ACID HYDROCHLORIDE could be employed in the study of enzyme mechanisms, protein interactions, and other biological processes. Its chiral nature and amino acid derivative structure may provide insights into the role of chirality in biological systems and contribute to a better understanding of biochemical phenomena.
Used in Material Science:
(R)-3-AMINO-4-(2-METHYLPHENYL)BUTANOIC ACID HYDROCHLORIDE may also find applications in material science, where its unique properties could be harnessed to develop new materials with specific characteristics. Its potential use in the synthesis of polymers, coatings, or other materials could lead to the creation of innovative products with improved performance and functionality.
Check Digit Verification of cas no
The CAS Registry Mumber 269398-79-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,6,9,3,9 and 8 respectively; the second part has 2 digits, 7 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 269398-79:
(8*2)+(7*6)+(6*9)+(5*3)+(4*9)+(3*8)+(2*7)+(1*9)=210
210 % 10 = 0
So 269398-79-0 is a valid CAS Registry Number.
InChI:InChI=1/C11H15NO2.ClH/c1-8-4-2-3-5-9(8)6-10(12)7-11(13)14;/h2-5,10H,6-7,12H2,1H3,(H,13,14);1H/t10-;/m1./s1
