269398-81-4 Usage
General Description
FMOC-(R)-3-Amino-4-(2-methyl-phenyl)-butyric acid is a complex chemical compound predominantly used in scientific research, specifically in peptide synthesis. The "FMOC" part refers to the Fluorenylmethyloxycarbonyl protecting group, utilized in organic chemistry to prevent unwanted reactions in certain parts of the molecule during a chemical reaction. The amino acid part of the compound, 3-amino-4-(2-methyl-phenyl)-butyric acid, is a derivative of butyric acid where an amino group and a 2-methylphenyl group have been substituted in. In summary, this compound plays an important role in peptide synthesis, allowing for the precise construction of specific protein sequences in lab conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 269398-81-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,6,9,3,9 and 8 respectively; the second part has 2 digits, 8 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 269398-81:
(8*2)+(7*6)+(6*9)+(5*3)+(4*9)+(3*8)+(2*8)+(1*1)=204
204 % 10 = 4
So 269398-81-4 is a valid CAS Registry Number.
InChI:InChI=1/C26H25NO4/c1-17-8-2-3-9-18(17)14-19(15-25(28)29)27-26(30)31-16-24-22-12-6-4-10-20(22)21-11-5-7-13-23(21)24/h2-13,19,24H,14-16H2,1H3,(H,27,30)(H,28,29)/t19-/m1/s1