269398-82-5 Usage
Uses
Used in Research Applications:
(R)-3-AMINO-4-(3-METHYLPHENYL)BUTANOIC ACID HYDROCHLORIDE is used as a research chemical for studying its structural properties and potential interactions with other compounds.
Used in Pharmaceutical Development:
(R)-3-AMINO-4-(3-METHYLPHENYL)BUTANOIC ACID HYDROCHLORIDE is used as a potential pharmaceutical intermediate, given its unique structure, which may contribute to the development of new drugs.
Used in Industrial Processes:
(R)-3-AMINO-4-(3-METHYLPHENYL)BUTANOIC ACID HYDROCHLORIDE is used as a chemical intermediate in various industrial processes, where its properties can be exploited for the synthesis of other compounds or materials.
Check Digit Verification of cas no
The CAS Registry Mumber 269398-82-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,6,9,3,9 and 8 respectively; the second part has 2 digits, 8 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 269398-82:
(8*2)+(7*6)+(6*9)+(5*3)+(4*9)+(3*8)+(2*8)+(1*2)=205
205 % 10 = 5
So 269398-82-5 is a valid CAS Registry Number.
InChI:InChI=1/C11H15NO2.ClH/c1-8-3-2-4-9(5-8)6-10(12)7-11(13)14;/h2-5,10H,6-7,12H2,1H3,(H,13,14);1H/t10-;/m1./s1
