269398-92-7 Usage
Uses
Used in Pharmaceutical Industry:
(R)-3-Amino-4-pentafluorophenylbutanoic acid hydrochloride is used as a chemical intermediate for the synthesis of pharmaceutical compounds. Its unique structure and reactivity make it a valuable building block in the development of new drugs, potentially contributing to the creation of novel therapeutic agents.
Used in Materials Science:
(R)-3-Amino-4-pentafluorophenylbutanoic acid hydrochloride is used as a precursor in the synthesis of advanced materials or coatings. Its chemical properties, such as the presence of both acidic and basic groups, may allow for the creation of new types of materials with specific properties, such as enhanced stability or reactivity, which could be applied in various fields, including electronics, aerospace, or automotive industries.
Check Digit Verification of cas no
The CAS Registry Mumber 269398-92-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,6,9,3,9 and 8 respectively; the second part has 2 digits, 9 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 269398-92:
(8*2)+(7*6)+(6*9)+(5*3)+(4*9)+(3*8)+(2*9)+(1*2)=207
207 % 10 = 7
So 269398-92-7 is a valid CAS Registry Number.
InChI:InChI=1/C10H8F5NO2.ClH/c11-6-4(1-3(16)2-5(17)18)7(12)9(14)10(15)8(6)13;/h3H,1-2,16H2,(H,17,18);1H/t3-;/m1./s1
