269726-85-4 Usage
Uses
Used in Pharmaceutical Industry:
(R)-3-AMINO-4-(4-CYANOPHENYL)BUTANOIC ACID HYDROCHLORIDE is used as a building block for the synthesis of various organic compounds, contributing to the development of new drugs and therapeutic agents. Its unique properties make it a valuable component in the creation of innovative pharmaceutical formulations.
Used in Research and Development:
In the field of research, (R)-3-AMINO-4-(4-CYANOPHENYL)BUTANOIC ACID HYDROCHLORIDE is utilized as a key component in the synthesis of complex organic molecules. Its versatility and reactivity enable researchers to explore new chemical pathways and develop novel compounds with potential applications in medicine and other industries.
Used in Drug Discovery and Development:
(R)-3-AMINO-4-(4-CYANOPHENYL)BUTANOIC ACID HYDROCHLORIDE plays a crucial role in drug discovery and development, as it serves as a precursor for the synthesis of new pharmaceutical compounds. Its potential therapeutic effects and pharmacological properties make it an important compound for the advancement of medical treatments and therapies.
Check Digit Verification of cas no
The CAS Registry Mumber 269726-85-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,6,9,7,2 and 6 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 269726-85:
(8*2)+(7*6)+(6*9)+(5*7)+(4*2)+(3*6)+(2*8)+(1*5)=194
194 % 10 = 4
So 269726-85-4 is a valid CAS Registry Number.
InChI:InChI=1/C11H12N2O2.ClH/c12-7-9-3-1-8(2-4-9)5-10(13)6-11(14)15;/h1-4,10H,5-6,13H2,(H,14,15);1H/t10-;/m1./s1
