269726-91-2 Usage
Uses
Used in Pharmaceutical Industry:
(R)-3-AMINO-4-(3-THIENYL)BUTANOIC ACID HYDROCHLORIDE is used as a synthetic intermediate for the development of drugs that aim to target specific biological pathways and receptors. Its unique structure allows for the creation of pharmaceuticals with potential therapeutic applications.
Used in Chemical Research and Development:
In the chemical industry, (R)-3-AMINO-4-(3-THIENYL)BUTANOIC ACID HYDROCHLORIDE serves as a key component in the synthesis of complex organic molecules. Its role in research and development is crucial for advancing the understanding of chemical reactions and the creation of new chemical entities with diverse applications.
Check Digit Verification of cas no
The CAS Registry Mumber 269726-91-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,6,9,7,2 and 6 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 269726-91:
(8*2)+(7*6)+(6*9)+(5*7)+(4*2)+(3*6)+(2*9)+(1*1)=192
192 % 10 = 2
So 269726-91-2 is a valid CAS Registry Number.
InChI:InChI=1/C8H11NO2S.ClH/c9-7(4-8(10)11)3-6-1-2-12-5-6;/h1-2,5,7H,3-4,9H2,(H,10,11);1H/t7-;/m1./s1
