26984-07-6 Usage
General Description
Delphinidin is a natural anthocyanin, a type of flavonoid pigment found in fruits and vegetables. It is responsible for the blue-red color of many berries, such as blueberries, blackberries, and cranberries. Delphinidin is known for its antioxidant properties, which can help protect cells from damage caused by harmful free radicals. Studies have also suggested that delphinidin may have potential health benefits, such as reducing inflammation, lowering blood sugar levels, and promoting heart health. Additionally, delphinidin may have antimicrobial and anti-cancer properties, making it a potentially valuable compound for medicinal and dietary applications.
Check Digit Verification of cas no
The CAS Registry Mumber 26984-07-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,6,9,8 and 4 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 26984-07:
(7*2)+(6*6)+(5*9)+(4*8)+(3*4)+(2*0)+(1*7)=146
146 % 10 = 6
So 26984-07-6 is a valid CAS Registry Number.
InChI:InChI=1/C21H20O12.ClH/c22-6-15-17(28)18(29)19(30)21(33-15)32-14-5-9-10(24)3-8(23)4-13(9)31-20(14)7-1-11(25)16(27)12(26)2-7;/h1-5,15,17-19,21-22,28-30H,6H2,(H4-,23,24,25,26,27);1H/t15?,17-,18?,19+,21-;/m0./s1