270063-55-3 Usage
General Description
The chemical Fmoc-(S)-3-Amino-4-(3,4-difluoro-phenyl)-butyric acid is a derivative of the amino acid 3-amino-4-(3,4-difluoro-phenyl)-butyric acid, with the addition of a protecting group (Fmoc) attached to the amino group. Fmoc-(S)-3-Amino-4-(3,4-difluoro-phenyl)-butyric acid is commonly used in peptide synthesis as a building block for creating custom peptides. The presence of the difluoro-phenyl group in the molecule may confer specific chemical and biological properties, and the Fmoc protecting group allows for selective deprotection during peptide synthesis. This chemical may have potential applications in research and pharmaceutical development due to its unique structure and potential biological activities.
Check Digit Verification of cas no
The CAS Registry Mumber 270063-55-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,7,0,0,6 and 3 respectively; the second part has 2 digits, 5 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 270063-55:
(8*2)+(7*7)+(6*0)+(5*0)+(4*6)+(3*3)+(2*5)+(1*5)=113
113 % 10 = 3
So 270063-55-3 is a valid CAS Registry Number.
InChI:InChI=1/C25H21F2NO4/c26-22-10-9-15(12-23(22)27)11-16(13-24(29)30)28-25(31)32-14-21-19-7-3-1-5-17(19)18-6-2-4-8-20(18)21/h1-10,12,16,21H,11,13-14H2,(H,28,31)(H,29,30)/t16-/m0/s1