270063-55-3 Usage
Uses
Used in Peptide Synthesis:
Fmoc-(S)-3-Amino-4-(3,4-difluoro-phenyl)-butyric acid is used as a building block for the synthesis of custom peptides, providing a unique structural element that can influence the properties and functions of the resulting peptide sequences. The Fmoc protecting group ensures that the amino group remains protected during the initial stages of peptide synthesis, allowing for selective deprotection and subsequent coupling reactions to construct the desired peptide chain.
Used in Pharmaceutical Development:
In the pharmaceutical industry, Fmoc-(S)-3-Amino-4-(3,4-difluoro-phenyl)-butyric acid is used as a key component in the development of novel therapeutic agents. The incorporation of Fmoc-(S)-3-Amino-4-(3,4-difluoro-phenyl)-butyric acid into peptide-based drugs can potentially enhance their biological activity, selectivity, and stability. The difluoro-phenyl group may confer specific binding affinities or modulate the pharmacokinetic properties of the peptide, making it a promising candidate for the treatment of various diseases and conditions.
Used in Research Applications:
Fmoc-(S)-3-Amino-4-(3,4-difluoro-phenyl)-butyric acid is utilized in research settings to explore its chemical and biological properties, as well as its potential applications in various scientific disciplines. Researchers may investigate its interactions with biological targets, its effects on cellular processes, and its potential as a scaffold for the development of new chemical entities with specific biological activities. Fmoc-(S)-3-Amino-4-(3,4-difluoro-phenyl)-butyric acid's unique structure and functional groups make it an interesting subject for studies aimed at understanding peptide-protein interactions, drug design, and the development of new therapeutic strategies.
Check Digit Verification of cas no
The CAS Registry Mumber 270063-55-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,7,0,0,6 and 3 respectively; the second part has 2 digits, 5 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 270063-55:
(8*2)+(7*7)+(6*0)+(5*0)+(4*6)+(3*3)+(2*5)+(1*5)=113
113 % 10 = 3
So 270063-55-3 is a valid CAS Registry Number.
InChI:InChI=1/C25H21F2NO4/c26-22-10-9-15(12-23(22)27)11-16(13-24(29)30)28-25(31)32-14-21-19-7-3-1-5-17(19)18-6-2-4-8-20(18)21/h1-10,12,16,21H,11,13-14H2,(H,28,31)(H,29,30)/t16-/m0/s1