27014-42-2 Usage
General Description
Ethylenediamineethoxylate, also known as EDAE, is a chemical compound that is used as a chelating agent, corrosion inhibitor, and surfactant in various industrial and commercial applications. Its main function is to form stable complexes with metal ions, making it effective in preventing the formation of scale and deposits in water treatment systems. EDAE is also used in the production of cleaning and personal care products, where its surfactant properties help to reduce surface tension and improve the wetting and spreading of the products. Additionally, it serves as an effective corrosion inhibitor in metalworking fluids and lubricants, helping to protect metal surfaces from degradation. Overall, ethylenediamineethoxylate is a versatile chemical that plays a crucial role in a wide range of industries.
Check Digit Verification of cas no
The CAS Registry Mumber 27014-42-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,7,0,1 and 4 respectively; the second part has 2 digits, 4 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 27014-42:
(7*2)+(6*7)+(5*0)+(4*1)+(3*4)+(2*4)+(1*2)=82
82 % 10 = 2
So 27014-42-2 is a valid CAS Registry Number.
InChI:InChI=1/C18H40N2O8/c21-7-15-25-11-3-19(4-12-26-16-8-22)1-2-20(5-13-27-17-9-23)6-14-28-18-10-24/h21-24H,1-18H2