27023-72-9 Usage
Explanation
Different sources of media describe the Explanation of 27023-72-9 differently. You can refer to the following data:
1. This is the formal IUPAC name for the compound, which describes its structure and composition.
2. The compound belongs to a class of chemicals known as benzodiazepines, which are widely used in the pharmaceutical industry.
3. Tricyclic Compound
3. It is a tricyclic compound, meaning it has three fused rings in its structure.
4. Four-member Ring
4. The compound has a four-member ring fused to the benzodiazepine ring system, which is a key structural feature.
5. Pharmaceutical Intermediate
5. It is commonly used as an intermediate in the synthesis of pharmaceutical drugs, particularly those that target the central nervous system.
6. Sedative Properties
6. The compound has sedative effects, which can help to calm and relax the user.
7. Hypnotic Properties
7. It also has hypnotic properties, which can induce sleep or a state of drowsiness.
8. Anxiolytic Properties
8. The compound is known for its anxiolytic effects, which can help to reduce feelings of anxiety and stress.
9. Anticonvulsant Properties
9. It has anticonvulsant properties, which can help to prevent or reduce the severity of seizures.
10. Muscle Relaxant Properties
10. The compound can also act as a muscle relaxant, helping to alleviate muscle spasms and tension.
11. Central Nervous System (CNS) Activity
11. The compound is known for its effects on the central nervous system, making it useful in the treatment of various conditions related to CNS dysfunction.
12. Potential for Dependence and Addiction
12. Misuse and overuse of the compound can lead to dependence and addiction, so it should be used with caution and under the guidance of a healthcare professional.
13. Treatment of Various Conditions
13. Due to its diverse properties, the compound can be used in the treatment of conditions such as anxiety, insomnia, seizures, and muscle spasms.
Chemical Group
Benzodiazepines
Check Digit Verification of cas no
The CAS Registry Mumber 27023-72-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,7,0,2 and 3 respectively; the second part has 2 digits, 7 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 27023-72:
(7*2)+(6*7)+(5*0)+(4*2)+(3*3)+(2*7)+(1*2)=89
89 % 10 = 9
So 27023-72-9 is a valid CAS Registry Number.
InChI:InChI=1/C10H12N2/c1-2-4-10-9(3-1)11-8-5-6-12(10)7-8/h1-4,8,11H,5-7H2
