270262-98-1 Usage
General Description
Fmoc-(S)-3-Amino-4-(2-thienyl)-butyric acid is a chemical compound used in peptide synthesis and drug development. It is a derivative of 3-amino-4-(2-thienyl)-butyric acid, with an Fmoc (Fluorenylmethyloxycarbonyl) protecting group attached to the amino group. Fmoc-(S)-3-Amino-4-(2-thienyl)-butyric acid is often used as a building block for the synthesis of peptides and other complex molecules. The incorporation of the (S)-stereoisomer in the molecule makes it useful for the development of pharmaceuticals and other bioactive compounds. Its unique structure and properties make it a valuable tool in the field of medicinal chemistry and drug discovery.
Check Digit Verification of cas no
The CAS Registry Mumber 270262-98-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,7,0,2,6 and 2 respectively; the second part has 2 digits, 9 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 270262-98:
(8*2)+(7*7)+(6*0)+(5*2)+(4*6)+(3*2)+(2*9)+(1*8)=131
131 % 10 = 1
So 270262-98-1 is a valid CAS Registry Number.
InChI:InChI=1/C23H21NO4S/c25-22(26)13-15(12-16-6-5-11-29-16)24-23(27)28-14-21-19-9-3-1-7-17(19)18-8-2-4-10-20(18)21/h1-11,15,21H,12-14H2,(H,24,27)(H,25,26)/t15-/m1/s1