270263-01-9 Usage
Description
Fmoc-(S)-3-Amino-4-(3-thienyl)-butyric acid is a synthetic compound derived from the amino acid threonine, featuring an additional 3-thienyl group. It is widely utilized in the realm of organic chemistry and peptide synthesis, serving as a crucial building block for the assembly of peptides and proteins. The Fmoc group attached to this compound acts as a protective group for the amine function, facilitating selective deprotection and coupling reactions in peptide synthesis. This versatile reagent is instrumental in the generation of diverse peptide and protein structures, which hold significant potential for pharmaceutical applications.
Uses
Used in Pharmaceutical Industry:
Fmoc-(S)-3-Amino-4-(3-thienyl)-butyric acid is used as a key building block for the synthesis of peptides and proteins with potential therapeutic applications. Its unique structure allows for the creation of peptide libraries that can be screened for drug discovery and development, leading to the identification of novel bioactive compounds.
Used in Peptide Synthesis:
In the field of peptide synthesis, Fmoc-(S)-3-Amino-4-(3-thienyl)-butyric acid is employed as a valuable reagent. The presence of the Fmoc group enables selective protection and deprotection of the amine group, allowing for efficient and controlled peptide assembly through stepwise coupling reactions. This selective protection is crucial for the synthesis of complex peptide sequences with high purity and yield.
Used in Organic Chemistry:
Fmoc-(S)-3-Amino-4-(3-thienyl)-butyric acid also finds applications in organic chemistry, where its unique structural features can be exploited for the development of novel chemical reactions and the synthesis of various organic compounds. The 3-thienyl group imparts specific chemical properties to the molecule, making it a versatile building block for the creation of diverse organic structures with potential applications in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 270263-01-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,7,0,2,6 and 3 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 270263-01:
(8*2)+(7*7)+(6*0)+(5*2)+(4*6)+(3*3)+(2*0)+(1*1)=109
109 % 10 = 9
So 270263-01-9 is a valid CAS Registry Number.
InChI:InChI=1/C23H21NO4S/c25-22(26)12-16(11-15-9-10-29-14-15)24-23(27)28-13-21-19-7-3-1-5-17(19)18-6-2-4-8-20(18)21/h1-10,14,16,21H,11-13H2,(H,24,27)(H,25,26)/t16-/m0/s1