270263-08-6 Usage
General Description
"(S)-3-Amino-(6-phenyl)-5-hexenoic acid hydrochloride" is a complex organic chemical compound. As the name suggests, this chemical comprises several different elements, such as amino and phenyl groups, positioned on a hexenoic acid backbone, and it is structurally characterized by its benzene ring and the presence of a chloride ion. The spatial arrangement of this molecule is determined by the "(S)" in its name, which refers to the "Sinister" (Latin for left) configuration in stereochemistry, indicating its 3D spatial orientation. It's most likely used in research and development activities in pharmaceutical labs or chemical industries. However, specific properties such as toxicity, reactivity, and its complete range of applications aren't provided in the given context. It is always essential to handle such chemical substances with care and adhere to safety guidelines and protocols.
Check Digit Verification of cas no
The CAS Registry Mumber 270263-08-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,7,0,2,6 and 3 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 270263-08:
(8*2)+(7*7)+(6*0)+(5*2)+(4*6)+(3*3)+(2*0)+(1*8)=116
116 % 10 = 6
So 270263-08-6 is a valid CAS Registry Number.
InChI:InChI=1/C12H15NO2.ClH/c13-11(9-12(14)15)8-4-7-10-5-2-1-3-6-10;/h1-7,11H,8-9,13H2,(H,14,15);1H/b7-4+;/t11-;/m0./s1
