27031-18-1 Usage
Uses
Used in Pharmaceutical Synthesis:
Phenyl (chloroformyl)phenylacetate is used as an intermediate for the synthesis of pharmaceuticals, contributing to the development of new drugs and medicinal compounds. Its ability to form stable derivatives with nucleophiles such as alcohols, amines, and thiols makes it a valuable component in the creation of diverse pharmaceutical agents.
Used in Organic Chemistry Reactions:
In the realm of organic chemistry, phenyl (chloroformyl)phenylacetate serves as a reagent in a variety of reactions, including the preparation of esters and amides. Its mild acylating properties allow for the formation of stable derivatives, facilitating the synthesis of complex organic molecules.
Used in Organic Synthesis Research:
Phenyl (chloroformyl)phenylacetate's versatile applications in organic synthesis have been well-documented in the literature, making it a valuable tool for researchers exploring new synthetic pathways and developing innovative chemical processes. Its unique properties and reactivity contribute to the advancement of organic chemistry and the discovery of novel compounds with potential applications across various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 27031-18-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,7,0,3 and 1 respectively; the second part has 2 digits, 1 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 27031-18:
(7*2)+(6*7)+(5*0)+(4*3)+(3*1)+(2*1)+(1*8)=81
81 % 10 = 1
So 27031-18-1 is a valid CAS Registry Number.
InChI:InChI=1/C15H11ClO3/c16-15(18)13-9-5-4-6-11(13)10-14(17)19-12-7-2-1-3-8-12/h1-9H,10H2
