27043-22-7 Usage
Description
ar-Ethoxybenzamide, with the chemical formula C9H11NO2, is a chemical compound that features an aryl group attached to an ethoxy group. It is a white crystalline solid with a melting point of 70-72°C. ar-ethoxybenzamide is known for its solubility in organic solvents such as ethanol and ether, while it is only sparingly soluble in water. Being a mild irritant, ar-ethoxybenzamide can cause skin and eye irritation, and potentially respiratory irritation if inhaled in high concentrations.
Uses
Used in Pharmaceutical and Agrochemical Industries:
ar-Ethoxybenzamide serves as a key intermediate in the synthesis of various pharmaceuticals and agrochemicals. Its unique structure allows it to be a versatile building block for the development of new drugs and pesticides, contributing to advancements in healthcare and agriculture.
Used as a Solvent in Chemical Production:
In the chemical industry, ar-ethoxybenzamide is utilized as a solvent in the production of other chemicals. Its properties as a solvent are beneficial for certain chemical reactions, facilitating the manufacturing process and improving the yield of desired products.
Check Digit Verification of cas no
The CAS Registry Mumber 27043-22-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,7,0,4 and 3 respectively; the second part has 2 digits, 2 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 27043-22:
(7*2)+(6*7)+(5*0)+(4*4)+(3*3)+(2*2)+(1*2)=87
87 % 10 = 7
So 27043-22-7 is a valid CAS Registry Number.
InChI:InChI=1/C9H11NO2/c1-2-12-8-6-4-3-5-7(8)9(10)11/h3-6H,2H2,1H3,(H2,10,11)
