270596-35-5 Usage
General Description
"(R)-3-AMINO-(6-PHENYL)-5-HEXENOIC ACID HYDROCHLORIDE" is a chemical compound that contains a hexenoic acid backbone along with an amino and phenyl functional group. It is a hydrochloride salt form of the compound, which means it is a salt that forms when a positively charged ammonium group of the compound interacts with a negatively charged chloride ion. (R)-3-AMINO-(6-PHENYL)-5-HEXENOIC ACID HYDROCHLORIDE may have potential applications in pharmaceuticals or organic synthesis due to its structural features, but further research and testing would be necessary to determine its specific properties and uses.
Check Digit Verification of cas no
The CAS Registry Mumber 270596-35-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,7,0,5,9 and 6 respectively; the second part has 2 digits, 3 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 270596-35:
(8*2)+(7*7)+(6*0)+(5*5)+(4*9)+(3*6)+(2*3)+(1*5)=155
155 % 10 = 5
So 270596-35-5 is a valid CAS Registry Number.
InChI:InChI=1/C12H15NO2.ClH/c13-11(9-12(14)15)8-4-7-10-5-2-1-3-6-10;/h1-7,11H,8-9,13H2,(H,14,15);1H/b7-4+;/t11-;/m1./s1