271-71-6 Usage
Description
1H-pyrazolo[3,4-b]pyridine is a heterocyclic chemical compound with the molecular formula C8H6N2. It belongs to the pyrazole and pyridine class of organic compounds and is characterized by its unique ring structure containing atoms other than carbon. 1H-pyrazolo[3,4-b]pyridine is known for its diverse biological activities and has shown promise as a building block for drug discovery. Its potential use in treating various diseases and its importance in chemical synthesis and medicinal chemistry research make it a valuable target for further investigation.
Uses
Used in Pharmaceutical Industry:
1H-pyrazolo[3,4-b]pyridine is used as a key intermediate in the synthesis of various pharmaceuticals for its potential therapeutic applications. Its unique structure and properties allow it to be a versatile building block in drug discovery, contributing to the development of new medications for treating a wide range of diseases.
Used in Agrochemical Industry:
1H-pyrazolo[3,4-b]pyridine is also used as a starting material in the synthesis of agrochemicals, particularly in the development of pesticides and other crop protection agents. Its diverse biological activities make it a valuable component in creating effective and targeted solutions for agricultural applications.
Used in Medicinal Chemistry Research:
1H-pyrazolo[3,4-b]pyridine serves as an important target for medicinal chemistry research, where its unique structure and properties are explored for potential applications in drug discovery and development. Researchers investigate its interactions with biological targets and its potential to modulate various biological pathways, leading to the creation of new therapeutic agents.
Used in Chemical Synthesis:
As a heterocyclic compound, 1H-pyrazolo[3,4-b]pyridine is utilized in various chemical synthesis processes. Its ability to form diverse chemical structures makes it a valuable component in the synthesis of complex organic molecules, which can be further used in pharmaceuticals, agrochemicals, and other industries.
Check Digit Verification of cas no
The CAS Registry Mumber 271-71-6 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 2,7 and 1 respectively; the second part has 2 digits, 7 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 271-71:
(5*2)+(4*7)+(3*1)+(2*7)+(1*1)=56
56 % 10 = 6
So 271-71-6 is a valid CAS Registry Number.
InChI:InChI=1/C6H5N3/c1-2-5-4-8-9-6(5)7-3-1/h1-4H,(H,7,8,9)