27127-62-4 Usage
Description
(4R)-4-[[(3S,6R,9S,12R,15S,18R,21R,22R)-3-[(2S)-butan-2-yl]-6,12-bis(hydroxymethyl)-22-methyl-9,15-bis(2-methylpropyl)-2,5,8,11,14,17,20-heptaoxo-18-propan-2-yl-1-oxa-4,7,10,13,16,19-hexazacyclodocos-21-yl]carbamoyl]-4-[[(2S)-2-[[(3R)-3-hydroxydecanoyl]amino]-4-methyl-pentanoyl]amino]butanoic acid is a complex organic molecule composed of amino acids and other compounds. It features various functional groups, including carboxylic acids, amines, and amides, as well as a cyclic structure. Its long and intricate chemical structure suggests potential biological or pharmaceutical applications, which would require further analysis and testing to determine its specific properties and uses.
Check Digit Verification of cas no
The CAS Registry Mumber 27127-62-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,7,1,2 and 7 respectively; the second part has 2 digits, 6 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 27127-62:
(7*2)+(6*7)+(5*1)+(4*2)+(3*7)+(2*6)+(1*2)=104
104 % 10 = 4
So 27127-62-4 is a valid CAS Registry Number.
InChI:InChI=1/C53H93N9O16/c1-13-15-16-17-18-33(65)24-40(66)54-35(21-27(3)4)46(70)55-34(19-20-41(67)68)45(69)62-44-32(12)78-53(77)43(31(11)14-2)61-50(74)39(26-64)59-47(71)36(22-28(5)6)56-49(73)38(25-63)58-48(72)37(23-29(7)8)57-51(75)42(30(9)10)60-52(44)76/h27-39,42-44,63-65H,13-26H2,1-12H3,(H,54,66)(H,55,70)(H,56,73)(H,57,75)(H,58,72)(H,59,71)(H,60,76)(H,61,74)(H,62,69)(H,67,68)/t31?,32?,33?,34-,35+,36+,37+,38-,39-,42-,43+,44+/m1/s1