27135-90-6 Usage
General Description
3a,4,5,6,7,7a-hexahydromethoxy-4,7-methano-1H-indene is a chemical compound that consists of a hexahydro structure with methoxy and methano functional groups. It is a cyclic compound with a fused ring system, containing six carbon atoms and one oxygen atom. The presence of methoxy and methano groups in the structure suggests potential reactivity and biological activity. 3a,4,5,6,7,7a-hexahydromethoxy-4,7-methano-1H-indene may have uses in organic synthesis, pharmaceutical development, or as a research reagent. Its complex structure and functional groups make it a potentially valuable compound for further study and exploration in the field of chemistry and pharmaceuticals.
Check Digit Verification of cas no
The CAS Registry Mumber 27135-90-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,7,1,3 and 5 respectively; the second part has 2 digits, 9 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 27135-90:
(7*2)+(6*7)+(5*1)+(4*3)+(3*5)+(2*9)+(1*0)=106
106 % 10 = 6
So 27135-90-6 is a valid CAS Registry Number.
InChI:InChI=1/C11H16O/c1-12-10-5-4-9-7-2-3-8(6-7)11(9)10/h4-5,7-11H,2-3,6H2,1H3