27146-64-1 Usage
Description
6-Hydrazinouracil, a chemical compound with the molecular formula C4H6N4O, is a derivative of uracil that features a hydrazine group. This versatile compound is recognized for its diverse applications across various fields, particularly in pharmaceuticals, agriculture, and cancer research.
Uses
Used in Pharmaceutical Industry:
6-Hydrazinouracil is utilized as a key intermediate in the synthesis of various antiviral drugs. Its unique structure allows it to play a crucial role in the development of medications designed to combat viral infections.
Used in Agricultural Chemicals:
In the agricultural sector, 6-Hydrazinouracil is employed as a plant growth regulator. Its ability to influence plant development and growth makes it a valuable component in the production of agrochemicals aimed at enhancing crop yields and quality.
Used in Cancer Research:
6-Hydrazinouracil has garnered interest in cancer research due to its potential to inhibit the growth of cancer cells. As a result, it is being studied for its possible application as an anticancer agent, offering a new avenue for the treatment of various types of cancer.
Check Digit Verification of cas no
The CAS Registry Mumber 27146-64-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,7,1,4 and 6 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 27146-64:
(7*2)+(6*7)+(5*1)+(4*4)+(3*6)+(2*6)+(1*4)=111
111 % 10 = 1
So 27146-64-1 is a valid CAS Registry Number.
InChI:InChI=1/C4H6N4O2/c5-8-2-1-3(9)7-4(10)6-2/h1,5H2,(H2,6,7,8,9,10)