27179-31-3 Usage
Uses
Used in Pharmaceutical Industry:
4-CHLORO-N-(2-PYRIMIDINYL)BUTANAMIDE is used as a chemical intermediate for the synthesis of various drugs and pharmaceutical products. It acts as a building block in the development of new medications and therapeutic agents, contributing to the advancement of healthcare and medical treatments.
Used in Drug Development:
4-CHLORO-N-(2-PYRIMIDINYL)BUTANAMIDE is utilized in the research and development of new drugs and therapeutic agents. Its unique chemical properties and potential reactivity in various chemical reactions make it a valuable component in the creation of innovative and effective medications.
Used in Medicinal Chemistry Research:
4-CHLORO-N-(2-PYRIMIDINYL)BUTANAMIDE is employed in medicinal chemistry research to study its potential applications and effects. Further research and testing are required to fully understand its capabilities and optimize its use in the development of pharmaceutical products.
Check Digit Verification of cas no
The CAS Registry Mumber 27179-31-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,7,1,7 and 9 respectively; the second part has 2 digits, 3 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 27179-31:
(7*2)+(6*7)+(5*1)+(4*7)+(3*9)+(2*3)+(1*1)=123
123 % 10 = 3
So 27179-31-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H10ClN3O/c9-4-1-3-7(13)12-8-10-5-2-6-11-8/h2,5-6H,1,3-4H2,(H,10,11,12,13)
