27236-80-2 Usage
Description
10-Undecenoyl chloride, with the chemical formula C11H19ClO, is an organic compound derived from undecylenic acid. It is a colorless to pale yellow liquid with a pungent odor and is highly reactive due to the presence of the acyl chloride functional group. This reactivity makes it a versatile building block in the synthesis of various chemicals, materials, and pharmaceuticals.
Uses
Used in Pharmaceutical Industry:
10-Undecenoyl chloride is used as a chemical intermediate for the synthesis of pharmaceuticals. Its reactivity allows for the formation of various drug molecules, contributing to the development of new medications.
Used in Agrochemical Industry:
In the agrochemical industry, 10-Undecenoyl chloride serves as a building block in the production of agrochemicals. Its ability to react with other compounds enables the creation of effective pesticides and other agricultural chemicals.
Used in Material Science:
10-Undecenoyl chloride is utilized in the synthesis of materials such as polymers and surfactants. Its reactive nature allows for the formation of diverse materials with specific properties, useful in various applications.
Used in Flavor and Fragrance Industry:
10-Undecenoyl chloride is employed in the production of flavors and fragrances. Its unique chemical structure contributes to the creation of distinct scents and tastes in various consumer products.
Used as a Chemical Intermediate in Industrial Processes:
10-Undecenoyl chloride is used as a chemical intermediate in various industrial processes. Its reactivity plays a crucial role in the synthesis of a wide range of compounds, driving innovation and development in multiple industries.
Check Digit Verification of cas no
The CAS Registry Mumber 27236-80-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,7,2,3 and 6 respectively; the second part has 2 digits, 8 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 27236-80:
(7*2)+(6*7)+(5*2)+(4*3)+(3*6)+(2*8)+(1*0)=112
112 % 10 = 2
So 27236-80-2 is a valid CAS Registry Number.
InChI:InChI=1/C11H19ClO/c1-2-3-4-5-6-7-8-9-10-11(12)13/h9-10H,2-8H2,1H3/b10-9+
