27238-39-7 Usage
Explanation
The compound is composed of 8 carbon atoms, 9 hydrogen atoms, and 5 nitrogen atoms.
Explanation
The compound is derived from benzotriazin-3-amine, with an additional methyl group attached to the 7th position of the molecule.
Explanation
The compound is used as an intermediate in the synthesis of various products, including pharmaceuticals, agrochemicals, and dyes. It also has potential applications in medicinal chemistry, research chemical production, and the development of new materials with specific properties.
Explanation
The presence of the methyl group at the 7th position of the benzotriazin-3-amine molecule contributes to its unique chemical and physical properties, making it a versatile chemical intermediate with potential industrial applications.
Explanation
The compound serves as a building block for the development of new drugs, as it can be incorporated into various chemical structures to create new pharmaceutical compounds.
Explanation
The compound's unique properties make it suitable for use in the production of research chemicals and the development of new materials with specific properties, which can be applied in various industries.
Molecular structure
Benzotriazin-3-amine derivative with a methyl group at the 7th position
Applications
Pharmaceutical synthesis, agrochemicals, dyes, medicinal chemistry, research chemicals, and new material development
Versatility
Unique chemical and physical properties due to the methyl group at the 7th position
Building block
Used in drug discovery and development
Industrial applications
Potential use in the production of research chemicals and development of new materials
Check Digit Verification of cas no
The CAS Registry Mumber 27238-39-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,7,2,3 and 8 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 27238-39:
(7*2)+(6*7)+(5*2)+(4*3)+(3*8)+(2*3)+(1*9)=117
117 % 10 = 7
So 27238-39-7 is a valid CAS Registry Number.
InChI:InChI=1/C8H8N4/c1-5-2-3-6-7(4-5)11-12-8(9)10-6/h2-4H,1H3,(H2,9,10,12)
