27238-40-0 Usage
Description
1,2,4-Benzotriazin-3-amine, 7-methoxyis a chemical compound with the molecular formula C8H8N4O. It is a derivative of benzotriazine, characterized by the presence of a methoxy group at the 7-position. This versatile compound has potential applications in the field of medicinal chemistry and drug development, particularly as an intermediate in the synthesis of pharmaceuticals and as a potential anti-cancer agent.
Uses
Used in Pharmaceutical Synthesis:
1,2,4-Benzotriazin-3-amine, 7-methoxyis used as an intermediate in the synthesis of various pharmaceuticals. Its unique chemical structure allows for the development of new drugs with potential therapeutic benefits.
Used in Anti-Cancer Applications:
1,2,4-Benzotriazin-3-amine, 7-methoxyis used as a potential anti-cancer agent. Its specific chemical properties may contribute to the inhibition of cancer cell growth and the development of new cancer treatments.
Used in Neurological Disorder Treatment:
1,2,4-Benzotriazin-3-amine, 7-methoxyhas been studied for its potential use in the treatment of neurological disorders. Its unique structure and properties may offer new avenues for the development of therapies to address these conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 27238-40-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,7,2,3 and 8 respectively; the second part has 2 digits, 4 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 27238-40:
(7*2)+(6*7)+(5*2)+(4*3)+(3*8)+(2*4)+(1*0)=110
110 % 10 = 0
So 27238-40-0 is a valid CAS Registry Number.
InChI:InChI=1/C8H8N4O/c1-13-5-2-3-6-7(4-5)11-12-8(9)10-6/h2-4H,1H3,(H2,9,10,12)
