27243-08-9 Usage
Uses
Used in Fragrance Industry:
2,4,8-trimethylnon-7-en-3-ol is used as a fragrance ingredient for its strong and distinctive odor. Its unique scent profile contributes to the creation of various perfumes, colognes, and other scented products, enhancing their appeal and complexity.
Used in Flavor Industry:
In the flavor industry, 2,4,8-trimethylnon-7-en-3-ol is used as a flavoring agent to impart specific taste and aroma characteristics to food and beverage products. Its unique flavor profile can be used to create or enhance the taste of various culinary creations.
Used in Medical and Biotechnology Applications:
2,4,8-trimethylnon-7-en-3-ol is used as a potential active ingredient in medical and biotechnological applications due to its biological activities. Its unique chemical structure may offer therapeutic benefits, such as antimicrobial, anti-inflammatory, or other medicinal properties, which can be explored for the development of new drugs or treatments.
Check Digit Verification of cas no
The CAS Registry Mumber 27243-08-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,7,2,4 and 3 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 27243-08:
(7*2)+(6*7)+(5*2)+(4*4)+(3*3)+(2*0)+(1*8)=99
99 % 10 = 9
So 27243-08-9 is a valid CAS Registry Number.
InChI:InChI=1/C12H24O/c1-9(2)7-6-8-11(5)12(13)10(3)4/h7,10-13H,6,8H2,1-5H3
